* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-BROMO-2-(3-CHLOROPHENYL)-1,5-DIMETHYL-1H-PYRAZOL-3(2H)-ONE |
| CAS: | 53221-62-8 |
| English Synonyms: | 4-BROMO-2-(3-CHLOROPHENYL)-1,5-DIMETHYL-1H-PYRAZOL-3(2H)-ONE |
| MDL Number.: | MFCD18382661 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1c(c(=O)n(n1C)c2cccc(c2)Cl)Br |
| InChi: | InChI=1S/C11H10BrClN2O/c1-7-10(12)11(16)15(14(7)2)9-5-3-4-8(13)6-9/h3-6H,1-2H3 |
| InChiKey: | InChIKey=ZQGVAAFLBAESQR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.