* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-VAL-PRO-OH |
| CAS: | 53331-43-4 |
| English Synonyms: | Z-VAL-PRO-OH |
| MDL Number.: | MFCD00191171 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C18H24N2O5/c1-12(2)15(16(21)20-10-6-9-14(20)17(22)23)19-18(24)25-11-13-7-4-3-5-8-13/h3-5,7-8,12,14-15H,6,9-11H2,1-2H3,(H,19,24)(H,22,23)/t14-,15-/m0/s1 |
| InChiKey: | InChIKey=GPECCBYSVGSBBG-GJZGRUSLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.