* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | AZANIDAZOLE |
| CAS: | 53409-75-9 ;62973-76-6 |
| English Synonyms: | AZANIDAZOLE |
| MDL Number.: | MFCD00866612 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | Cn1c(cnc1/C=C/c2ccnc(n2)N)[N+](=O)[O-] |
| InChi: | InChI=1S/C10H10N6O2/c1-15-8(13-6-9(15)16(17)18)3-2-7-4-5-12-10(11)14-7/h2-6H,1H3,(H2,11,12,14)/b3-2+ |
| InChiKey: | InChIKey=LHIALLMPKJMSIQ-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.