* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1H-IMIDAZO[4,5-G]QUINAZOLIN-8-AMINE |
CAS: | 53449-12-0 |
English Synonyms: | 1H-IMIDAZO[4,5-G]QUINAZOLIN-8-AMINE |
MDL Number.: | MFCD18808187 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1c2c(cc3c1[nH]cn3)ncnc2N |
InChi: | InChI=1S/C9H7N5/c10-9-5-1-7-8(13-3-12-7)2-6(5)11-4-14-9/h1-4H,(H,12,13)(H2,10,11,14) |
InChiKey: | InChIKey=SBXGLRVKJCXOHQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.