* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CRETICOSIDE C |
CAS: | 53452-34-9 |
English Synonyms: | CRETICOSIDE C |
MDL Number.: | MFCD17214900 |
H bond acceptor: | 8 |
H bond donor: | 6 |
Smile: | CC1(C[C@H](C[C@@]2([C@@H]1[C@@H](C[C@]34[C@H]2CC[C@H](C3)[C@](C4)(C)O)O)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C |
InChi: | InChI=1S/C26H44O8/c1-23(2)8-14(33-22-20(31)19(30)18(29)16(11-27)34-22)9-24(3)17-6-5-13-7-26(17,12-25(13,4)32)10-15(28)21(23)24/h13-22,27-32H,5-12H2,1-4H3/t13-,14-,15-,16-,17+,18-,19+,20-,21-,22-,24+,25-,26-/m1/s1 |
InChiKey: | InChIKey=RGKNTHMUHXNDHJ-UBQJNZDZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.