* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-ALLYL-6-CHLOROPHENOL |
| CAS: | 5348-07-2 |
| English Synonyms: | 2-ALLYL-6-CHLOROPHENOL ; 2-CHLORO-6-(PROP-2-EN-1-YL)PHENOL |
| MDL Number.: | MFCD00045747 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | C=CCc1cccc(c1O)Cl |
| InChi: | InChI=1S/C9H9ClO/c1-2-4-7-5-3-6-8(10)9(7)11/h2-3,5-6,11H,1,4H2 |
| InChiKey: | InChIKey=UPEBXJHGPMUFKU-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.