* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (S)-1-AMINO-3-CHLORO-2-PROPANOL |
CAS: | 53494-57-8 |
English Synonyms: | (S)-1-AMINO-3-CHLORO-2-PROPANOL |
MDL Number.: | MFCD17215646 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C([C@@H](CCl)O)N |
InChi: | InChI=1S/C3H8ClNO/c4-1-3(6)2-5/h3,6H,1-2,5H2/t3-/m1/s1 |
InChiKey: | InChIKey=CYJBWQFWXJKKMS-GSVOUGTGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.