* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLYBUTHIAZOL |
| CAS: | 535-65-9 |
| English Synonyms: | GLYBUTHIAZOL |
| MDL Number.: | MFCD00865511 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)c1nnc(s1)NS(=O)(=O)c2ccc(cc2)N |
| InChi: | InChI=1S/C12H16N4O2S2/c1-12(2,3)10-14-15-11(19-10)16-20(17,18)9-6-4-8(13)5-7-9/h4-7H,13H2,1-3H3,(H,15,16) |
| InChiKey: | InChIKey=DVQVBLBKEXITIK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.