* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1H-INDEN-1-ONE, 7-ETHYL-2,3-DIHYDRO- |
CAS: | 535969-21-2 |
English Synonyms: | 7-ETHYLINDAN-1-ONE ; 1H-INDEN-1-ONE, 7-ETHYL-2,3-DIHYDRO- ; 7-ETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE |
MDL Number.: | MFCD18647723 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCc1cccc2c1C(=O)CC2 |
InChi: | InChI=1S/C11H12O/c1-2-8-4-3-5-9-6-7-10(12)11(8)9/h3-5H,2,6-7H2,1H3 |
InChiKey: | InChIKey=IZCAVGHDKBRJEE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.