* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1H-ISOINDOLE,2,3,3A,7A-TETRAHYDRO- |
CAS: | 53632-90-9 |
English Synonyms: | 2,3,3A,7A-TETRAHYDRO-1H-ISOINDOLE ; 1H-ISOINDOLE,2,3,3A,7A-TETRAHYDRO- |
MDL Number.: | MFCD18835716 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1C2C=CC=CC2CN1 |
InChi: | InChI=1S/C8H11N/c1-2-4-8-6-9-5-7(8)3-1/h1-4,7-9H,5-6H2 |
InChiKey: | InChIKey=DJKGYCLMLZOICD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.