* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | CYCLOPENTANONE, 2-METHYL-3-[(1R)-1-METHYL-2-PROPENYL]-, (2R,3R)- |
CAS: | 536737-35-6 |
English Synonyms: | CYCLOPENTANONE, 2-METHYL-3-[(1R)-1-METHYL-2-PROPENYL]-, (2R,3R)- |
MDL Number.: | MFCD18832881 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C[C@@H]1[C@H](CCC1=O)[C@H](C)C=C |
InChi: | InChI=1S/C10H16O/c1-4-7(2)9-5-6-10(11)8(9)3/h4,7-9H,1,5-6H2,2-3H3/t7-,8-,9-/m1/s1 |
InChiKey: | InChIKey=HZPTUZOVSXOQLC-IWSPIJDZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.