* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LYCLANINOL |
| CAS: | 53755-76-3 |
| English Synonyms: | LYCLANINOL |
| MDL Number.: | MFCD17214903 |
| H bond acceptor: | 4 |
| H bond donor: | 4 |
| Smile: | CC1([C@@H]2CC=C3C[C@@]4(CC[C@@H]5[C@@]([C@H]4CC[C@@H]3[C@]2(C[C@H]([C@H]1O)O)C)(CC[C@H]([C@]5(C)CO)O)C)C)C |
| InChi: | InChI=1S/C30H50O4/c1-26(2)21-9-7-18-15-27(3)13-11-23-28(4,14-12-24(33)30(23,6)17-31)22(27)10-8-19(18)29(21,5)16-20(32)25(26)34/h7,19-25,31-34H,8-17H2,1-6H3/t19-,20+,21-,22-,23+,24+,25+,27-,28+,29+,30+/m0/s1 |
| InChiKey: | InChIKey=MRQRSMCZZRLXJG-AGTZBQNOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.