* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BICYCLO[3.1.1]HEPTAN-2-AMINE, 6,6-DIMETHYL-, (1ALPHA,2BETA,5ALPHA)- |
| CAS: | 53767-59-2 |
| English Synonyms: | BICYCLO[3.1.1]HEPTAN-2-AMINE, 6,6-DIMETHYL-, (1ALPHA,2BETA,5ALPHA)- |
| MDL Number.: | MFCD17019482 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CC1([C@H]2CC[C@H]([C@@H]1C2)N)C |
| InChi: | InChI=1S/C9H17N/c1-9(2)6-3-4-8(10)7(9)5-6/h6-8H,3-5,10H2,1-2H3/t6-,7-,8+/m0/s1 |
| InChiKey: | InChIKey=VFQYFRUGGATHGJ-BIIVOSGPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.