* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-D-THR(ME)-OH |
CAS: | 537697-28-2 |
English Synonyms: | H-D-THR(ME)-OH ; O-METHYL-D-THREONINE |
MDL Number.: | MFCD09752879 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C[C@@H]([C@H](C(=O)O)N)OC |
InChi: | InChI=1S/C5H11NO3/c1-3(9-2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t3-,4+/m0/s1 |
InChiKey: | InChIKey=FYCWLJLGIAUCCL-IUYQGCFVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.