* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-Azido-L-phenylalanine |
CAS: | 53774-67-7 |
English Synonyms: | 3-AZIDO-L-PHENYLALANINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])C=1C=C(C[C@H](N)C(=O)O)C=CC1 |
InChi: | InChI=1S/C9H10N4O2/c10-8(9(14)15)5-6-2-1-3-7(4-6)12-13-11/h1-4,8H,5,10H2,(H,14,15)/t8-/m0/s1 |
InChiKey: | InChIKey=BVCKZFDZBDTBTI-QMMMGPOBSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.