* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(3-METHOXYPHENYL)-1,3,4-OXADIAZOLE |
CAS: | 5378-30-3 |
English Synonyms: | 1,3,4-OXADIAZOLE, 2-(3-METHOXYPHENYL)- ; 2-(3-METHOXYPHENYL)-1,3,4-OXADIAZOLE |
MDL Number.: | MFCD09755524 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COc1cccc(c1)c2nnco2 |
InChi: | InChI=1S/C9H8N2O2/c1-12-8-4-2-3-7(5-8)9-11-10-6-13-9/h2-6H,1H3 |
InChiKey: | InChIKey=HNLLIIVZVPRWMQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.