* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(3-CHLOROPHENYL)-1,3,4-OXADIAZOLE |
CAS: | 5378-33-6 |
English Synonyms: | 2-(3-CHLOROPHENYL)-1,3,4-OXADIAZOLE |
MDL Number.: | MFCD09881167 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(cc(c1)Cl)c2nnco2 |
InChi: | InChI=1S/C8H5ClN2O/c9-7-3-1-2-6(4-7)8-11-10-5-12-8/h1-5H |
InChiKey: | InChIKey=PPPRLXXCIJKANA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.