* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,9-DIMETHYL-10(9H)-ACRIDINYL |
CAS: | 53884-62-1 |
English Synonyms: | 9,9-DIMETHYL-10(9H)-ACRIDINYL ; 9,9-DIMETHYL-9,10-DIHYDRO-ACRIDINE ; RARECHEM FH 10 0S54 |
MDL Number.: | MFCD00030130 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC1(c2ccccc2Nc3c1cccc3)C |
InChi: | InChI=1S/C15H15N/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h3-10,16H,1-2H3 |
InChiKey: | InChIKey=JSEQNGYLWKBMJI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.