* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-METHOXY-1,2-DIMETHYL-6-NITRO-1H-INDOLE |
CAS: | 53918-84-6 |
English Synonyms: | 5-METHOXY-1,2-DIMETHYL-6-NITRO-1H-INDOLE |
MDL Number.: | MFCD18377769 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1cc2cc(c(cc2n1C)[N+](=O)[O-])OC |
InChi: | InChI=1S/C11H12N2O3/c1-7-4-8-5-11(16-3)10(13(14)15)6-9(8)12(7)2/h4-6H,1-3H3 |
InChiKey: | InChIKey=SYTNQFPMEUPDRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.