* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FLOXACRINE |
CAS: | 53966-34-0 |
English Synonyms: | FLOXACRINE |
MDL Number.: | MFCD00866197 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(ccc1C2Cc3c(c(=O)c4cc(ccc4n3O)Cl)C(=O)C2)C(F)(F)F |
InChi: | InChI=1S/C20H13ClF3NO3/c21-13-5-6-15-14(9-13)19(27)18-16(25(15)28)7-11(8-17(18)26)10-1-3-12(4-2-10)20(22,23)24/h1-6,9,11,28H,7-8H2 |
InChiKey: | InChIKey=AWHZKKVSUJJVNL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.