* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | PURPUROMYCIN |
CAS: | 53969-01-0 |
English Synonyms: | PURPUROMYCIN |
MDL Number.: | MFCD00896370 |
H bond acceptor: | 13 |
H bond donor: | 4 |
Smile: | COC1=CC(=O)c2c(c(c3c(c2O)CC4(O3)CC(c5cc6cc(oc(=O)c6c(c5O4)O)C(=O)OC)O)O)C1=O |
InChi: | InChI=1S/C26H18O13/c1-35-13-5-11(27)16-17(19(13)30)21(32)23-10(18(16)29)6-26(39-23)7-12(28)9-3-8-4-14(24(33)36-2)37-25(34)15(8)20(31)22(9)38-26/h3-5,12,28-29,31-32H,6-7H2,1-2H3 |
InChiKey: | InChIKey=VGXVKHPGBHVPMW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.