* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-(4-FLUOROPHENYL)-1,5-DIMETHYL-1H-PYRAZOL-3(2H)-ONE |
CAS: | 5400-60-2 |
English Synonyms: | 2-(4-FLUOROPHENYL)-1,5-DIMETHYL-1H-PYRAZOL-3(2H)-ONE |
MDL Number.: | MFCD18382610 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1cc(=O)n(n1C)c2ccc(cc2)F |
InChi: | InChI=1S/C11H11FN2O/c1-8-7-11(15)14(13(8)2)10-5-3-9(12)4-6-10/h3-7H,1-2H3 |
InChiKey: | InChIKey=DPSOQADTQNTSSG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.