* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 13-ETHYL-11-METHYLENE-GON-4-ENE-3,17-DIONE |
CAS: | 54024-17-8 |
English Synonyms: | 13-ETHYL-11-METHYLENE-GON-4-ENE-3,17-DIONE ; 11-METHYLENE-18-METHYL-4-ESTRENE-3,17-DIONE ; 13-ETHYL-11-METHYLENE-GON-4(5)-3,17-DIONE |
MDL Number.: | MFCD08458337 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC[C@]12CC(=C)[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=CC(=O)CC[C@H]34 |
InChi: | InChI=1S/C20H26O2/c1-3-20-11-12(2)19-15-7-5-14(21)10-13(15)4-6-16(19)17(20)8-9-18(20)22/h10,15-17,19H,2-9,11H2,1H3/t15-,16-,17-,19+,20-/m0/s1 |
InChiKey: | InChIKey=QSUOYDLHCFPVMW-CAVMOMJPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.