* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FLUORESCENT RED MEGA 500 |
CAS: | 540528-13-0 |
English Synonyms: | FLUORESCENT RED MEGA 500 |
MDL Number.: | MFCD06798196 |
H bond acceptor: | 10 |
H bond donor: | 2 |
Smile: | CCN(CC)c1ccc2c(c1)oc(=O)c(c2O)/C=C/C3=[N+](c4ccc(cc4C3(C)C)S(=O)(=O)[O-])CCCCCC(=O)O |
InChi: | InChI=1S/C31H36N2O8S/c1-5-32(6-2)20-11-13-22-26(18-20)41-30(37)23(29(22)36)14-16-27-31(3,4)24-19-21(42(38,39)40)12-15-25(24)33(27)17-9-7-8-10-28(34)35/h11-16,18-19H,5-10,17H2,1-4H3,(H2,34,35,38,39,40) |
InChiKey: | InChIKey=ACILOXWOYCJZEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.