* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-METHYLACRIDINE |
CAS: | 23043-41-6 ;54116-90-4 |
English Synonyms: | ACRIDINE, 1-METHYL- ; 1-METHYLACRIDINE |
MDL Number.: | MFCD03079151 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cc1cccc2c1cc3ccccc3n2 |
InChi: | InChI=1S/C14H11N/c1-10-5-4-8-14-12(10)9-11-6-2-3-7-13(11)15-14/h2-9H,1H3 |
InChiKey: | InChIKey=VXGOQVMIGNMUGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.