* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6H-THIENO[3,2-F][1,2,4]TRIAZOLO[4,3-A][1,4]DIAZEPINE, 9-METHYL-4-PHENYL- |
CAS: | 54123-09-0 |
English Synonyms: | 6H-THIENO[3,2-F][1,2,4]TRIAZOLO[4,3-A][1,4]DIAZEPINE, 9-METHYL-4-PHENYL- ; RO11-1464 ; 9-METHYL-4-PHENYL-6H-THIENO[3,2-F][1,2,4]TRIAZOLO[4,3-A][1,4]DIAZEPINE |
MDL Number.: | MFCD17019485 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cc1nnc2n1-c3c(ccs3)C(=NC2)c4ccccc4 |
InChi: | InChI=1S/C15H12N4S/c1-10-17-18-13-9-16-14(11-5-3-2-4-6-11)12-7-8-20-15(12)19(10)13/h2-8H,9H2,1H3 |
InChiKey: | InChIKey=SIRFTOWPWPCSOP-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.