* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | QUINAZOLINE, 1-OXIDE |
CAS: | 54145-20-9 |
English Synonyms: | QUINAZOLINE, 1-OXIDE |
MDL Number.: | MFCD18377830 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)cncn2=O |
InChi: | InChI=1S/C8H6N2O/c11-10-6-9-5-7-3-1-2-4-8(7)10/h1-6H |
InChiKey: | InChIKey=NLHOVYMVGLRDPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.