* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-CHLORO-1-IODO-2-BUTENE |
CAS: | 54201-06-8 |
English Synonyms: | 3-CHLORO-1-IODO-2-BUTENE |
MDL Number.: | MFCD17013380 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C/C(=C\CI)/Cl |
InChi: | InChI=1S/C4H6ClI/c1-4(5)2-3-6/h2H,3H2,1H3/b4-2+ |
InChiKey: | InChIKey=XIGISXDJPIFSMC-DUXPYHPUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.