* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | BERYLIUM ACETATE |
CAS: | 543-81-7 |
English Synonyms: | BERYLIUM ACETATE |
MDL Number.: | MFCD12401669 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | [Be+2].CC(=O)[O-].CC(=O)[O-] |
InChi: | InChI=1S/2C2H4O2.Be/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
InChiKey: | InChIKey=YUOUKRIPFJKDJY-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.