* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(3-ETHYL-2,6-DIHYDROXYPHENYL)ETHAN-1-ONE |
CAS: | 54337-59-6 |
English Synonyms: | 1-(3-ETHYL-2,6-DIHYDROXYPHENYL)ETHAN-1-ONE |
MDL Number.: | MFCD00100621 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCc1ccc(c(c1O)C(=O)C)O |
InChi: | InChI=1S/C10H12O3/c1-3-7-4-5-8(12)9(6(2)11)10(7)13/h4-5,12-13H,3H2,1-2H3 |
InChiKey: | InChIKey=SIPMOJWONWOACW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.