* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOADIANTONE |
CAS: | 54352-47-5 |
English Synonyms: | ISOADIANTONE |
MDL Number.: | MFCD01711906 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(=O)[C@@H]1CC[C@]2([C@H]1CC[C@@]3([C@@H]2CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCCC5(C)C)C)C)C)C |
InChi: | InChI=1S/C29H48O/c1-19(30)20-11-16-26(4)21(20)12-17-28(6)23(26)9-10-24-27(5)15-8-14-25(2,3)22(27)13-18-29(24,28)7/h20-24H,8-18H2,1-7H3/t20-,21-,22-,23+,24+,26-,27-,28+,29+/m0/s1 |
InChiKey: | InChIKey=DCBAVUVLEYSTPU-ZTPVQENVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.