* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (S,S)-F-BINAPHANE |
CAS: | 544461-38-3 |
English Synonyms: | (S,S)-F-BINAPHANE |
MDL Number.: | MFCD09842757 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)ccc3c2-c4c(ccc5c4cccc5)CP(C3)[C]6[CH][CH][CH][CH]6.c1ccc2c(c1)ccc3c2-c4c(ccc5c4cccc5)CP(C3)[C]6[CH][CH][CH][CH]6.[Fe] |
InChi: | InChI=1S/2C27H20P.Fe/c2*1-5-11-24-19(7-1)13-15-21-17-28(23-9-3-4-10-23)18-22-16-14-20-8-2-6-12-25(20)27(22)26(21)24;/h2*1-16H,17-18H2; |
InChiKey: | InChIKey=LKNXQPPPQGIJLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.