Molecular Structure:
CAS No.:
5447-99-4
Product Name.:
CCD No.:CCD00007102
Formula:C5 H11 N O3
MolWeight:133.146
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(13)
- Buyers(0)
- Spectrum(0)
- MSDS(1)
- Price(5)
|
|
| Product Name： | 3-NITRO-2-PENTANOL |
| CAS： | 5447-99-4 |
| English Synonyms： | 3-NITRO-2-PENTANOL ; 3-NITROPENTAN-2-OL |
| MDL Number.： | MFCD00007399 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCC(C(C)O)[N+](=O)[O-] |
| InChi： | InChI=1S/C5H11NO3/c1-3-5(4(2)7)6(8)9/h4-5,7H,3H2,1-2H3 |
| InChiKey： | InChIKey=CHOTTWGZEKCPHA-UHFFFAOYSA-N |
|
|
| Boiling Point： | 60 DEG C/0.5 MMHG(LIT) |
| Density： | DENSITY: 1.075 G/ML AT 25 DEG C(LIT) |
| Physical Property： | FLASHPOINT: 195.8 DEG F FLASHPOINT: 91 DEG C REFRACTIVE INDEX: N20/D 1.443(LIT) |
| Comments： | UNSPSC: 12352100 WGK: 3 |
| Information： | MIXTURE OF (+/-)-THREO AND (+/-)-ERYTHRO |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
