* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1'-Biphenyl]-4-acetic acid, α-oxo- |
CAS: | 5449-21-8 |
English Synonyms: | [1,1'-BIPHENYL]-4-ACETIC ACID, Α-OXO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | O=C(C(=O)O)C1=CC=C(C=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C14H10O3/c15-13(14(16)17)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H,16,17) |
InChiKey: | InChIKey=DRFCZRDAUHIVIG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.