* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-BROMO-2-BUTOXYBENZENE |
CAS: | 54514-30-6 |
English Synonyms: | 1-BROMO-2-BUTOXYBENZENE |
MDL Number.: | MFCD09942935 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCCCOc1ccccc1Br |
InChi: | InChI=1S/C10H13BrO/c1-2-3-8-12-10-7-5-4-6-9(10)11/h4-7H,2-3,8H2,1H3 |
InChiKey: | InChIKey=HFEFLNNDSLOUEM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.