* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | POMIFERIN-3',4'-DIMETHYL ETHER |
CAS: | 5456-71-3 |
English Synonyms: | POMIFERIN-3',4'-DIMETHYL ETHER |
MDL Number.: | MFCD00075997 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(=CCc1c(c2c(=O)c(coc2c3c1OC(C=C3)(C)C)c4ccc(c(c4)OC)OC)O)C |
InChi: | InChI=1S/C27H28O6/c1-15(2)7-9-17-23(28)22-24(29)19(16-8-10-20(30-5)21(13-16)31-6)14-32-26(22)18-11-12-27(3,4)33-25(17)18/h7-8,10-14,28H,9H2,1-6H3 |
InChiKey: | InChIKey=LQYJACCCVUEHFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.