* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-Imidazol-2-amine, N-phenyl- |
CAS: | 54707-87-8 |
English Synonyms: | 1H-IMIDAZOL-2-AMINE, N-PHENYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=CC=C1)NC=1NC=CN1 |
InChi: | InChI=1S/C9H9N3/c1-2-4-8(5-3-1)12-9-10-6-7-11-9/h1-7H,(H2,10,11,12) |
InChiKey: | InChIKey=YCAXQAUEKMQYQH-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.