* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,6-BIS(4-METHOXYPHENYL)-1,2,4-TRIAZIN-3(2H)-ONE |
CAS: | 5471-46-5 |
English Synonyms: | 5,6-BIS(4-METHOXYPHENYL)-1,2,4-TRIAZIN-3(2H)-ONE |
MDL Number.: | MFCD18428943 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COc1ccc(cc1)c2c(n[nH]c(=O)n2)c3ccc(cc3)OC |
InChi: | InChI=1S/C17H15N3O3/c1-22-13-7-3-11(4-8-13)15-16(19-20-17(21)18-15)12-5-9-14(23-2)10-6-12/h3-10H,1-2H3,(H,18,20,21) |
InChiKey: | InChIKey=NDTQIXGIWFMLRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.