* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLYCINE, [14C(U)] |
| CAS: | 54745-47-0 |
| English Synonyms: | GLYCINE, [14C(U)] |
| MDL Number.: | MFCD00069945 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | [14CH2]([14C](=O)O)N |
| InChi: | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/i1+2,2+2 |
| InChiKey: | InChIKey=DHMQDGOQFOQNFH-XPULMUKRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.