* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-AMINOELLIPTICINE |
CAS: | 54779-53-2 |
English Synonyms: | 9-AMINOELLIPTICINE |
MDL Number.: | MFCD01690692 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1c2ccncc2c(c3c1[nH]c4c3cc(cc4)N)C |
InChi: | InChI=1S/C17H15N3/c1-9-14-8-19-6-5-12(14)10(2)17-16(9)13-7-11(18)3-4-15(13)20-17/h3-8,20H,18H2,1-2H3 |
InChiKey: | InChIKey=PCLRPEZTOOYTNQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.