* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GYROPHORIC ACID |
| CAS: | 548-89-0 |
| English Synonyms: | GYROPHORIC ACID |
| MDL Number.: | MFCD00597017 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | Cc1cc(cc(c1C(=O)Oc2cc(c(c(c2)O)C(=O)Oc3cc(c(c(c3)O)C(=O)O)C)C)O)O |
| InChi: | InChI=1S/C24H20O10/c1-10-4-13(25)7-16(26)20(10)23(31)34-15-6-12(3)21(18(28)9-15)24(32)33-14-5-11(2)19(22(29)30)17(27)8-14/h4-9,25-28H,1-3H3,(H,29,30) |
| InChiKey: | InChIKey=ATQPZSQVWCPVGV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.