* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | BICYCLO[3.1.0]HEX-2-ENE-2-CARBOXALDEHYDE, 5-(1-METHYLETHYL)-, (1S)- |
CAS: | 54825-98-8 |
English Synonyms: | BICYCLO[3.1.0]HEX-2-ENE-2-CARBOXALDEHYDE, 5-(1-METHYLETHYL)-, (1S)- |
MDL Number.: | MFCD18835986 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(C)C12CC=C([C@H]1C2)C=O |
InChi: | InChI=1S/C10H14O/c1-7(2)10-4-3-8(6-11)9(10)5-10/h3,6-7,9H,4-5H2,1-2H3/t9-,10?/m1/s1 |
InChiKey: | InChIKey=YZNIFKFTGCAOST-YHMJZVADSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.