* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-BENZOYLQUINOLINE |
CAS: | 54885-04-0 |
English Synonyms: | 8-BENZOYLQUINOLINE |
MDL Number.: | MFCD17133593 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)C(=O)c2cccc3c2nccc3 |
InChi: | InChI=1S/C16H11NO/c18-16(13-6-2-1-3-7-13)14-10-4-8-12-9-5-11-17-15(12)14/h1-11H |
InChiKey: | InChIKey=XGLCXRBETLAFRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.