* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-GLY-D-PHE-OH |
CAS: | 54885-66-4 |
English Synonyms: | Z-GLY-D-PHE-OH |
MDL Number.: | MFCD00136562 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)C[C@H](C(=O)O)NC(=O)CNC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C19H20N2O5/c22-17(12-20-19(25)26-13-15-9-5-2-6-10-15)21-16(18(23)24)11-14-7-3-1-4-8-14/h1-10,16H,11-13H2,(H,20,25)(H,21,22)(H,23,24)/t16-/m1/s1 |
InChiKey: | InChIKey=FLGYJBNDDWLTQR-MRXNPFEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.