* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-PROPYN-1-OL,3-(1H-BENZIMIDAZOL-2-YL)- |
CAS: | 54886-04-3 |
English Synonyms: | 3-(1H-1,3-BENZODIAZOL-2-YL)PROP-2-YN-1-OL ; 2-PROPYN-1-OL,3-(1H-BENZIMIDAZOL-2-YL)- |
MDL Number.: | MFCD18816259 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)[nH]c(n2)C#CCO |
InChi: | InChI=1S/C10H8N2O/c13-7-3-6-10-11-8-4-1-2-5-9(8)12-10/h1-2,4-5,13H,7H2,(H,11,12) |
InChiKey: | InChIKey=RMAYFXPAFIRBKJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.