* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3AR,9BR)-2,3,3A,4,5,9B-HEXAHYDRO-1H-BENZO[E]ISOINDOLE |
CAS: | 54915-14-9 |
English Synonyms: | (3AR,9BR)-2,3,3A,4,5,9B-HEXAHYDRO-1H-BENZO[E]ISOINDOLE |
MDL Number.: | MFCD18434505 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)CC[C@@H]3[C@H]2CNC3 |
InChi: | InChI=1S/C12H15N/c1-2-4-11-9(3-1)5-6-10-7-13-8-12(10)11/h1-4,10,12-13H,5-8H2/t10-,12+/m0/s1 |
InChiKey: | InChIKey=AFUKREKRACCNKC-CMPLNLGQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.