* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,7-NAPHTHYRIDIN-2-AMINE |
CAS: | 54920-84-2 |
English Synonyms: | 1,7-NAPHTHYRIDIN-2-AMINE ; 2-AMINO-1,7-NAPHTHYRIDINE |
MDL Number.: | MFCD18384671 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(nc2c1ccnc2)N |
InChi: | InChI=1S/C8H7N3/c9-8-2-1-6-3-4-10-5-7(6)11-8/h1-5H,(H2,9,11) |
InChiKey: | InChIKey=KOWFARGAWQOYIZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.