* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,7-DICHLORO-5H-PYRIMIDO[5,4-B]INDOLE |
CAS: | 549488-70-2 |
English Synonyms: | 4,7-DICHLORO-5H-PYRIMIDO[5,4-B]INDOLE ; 5H-PYRIMIDO[5,4-B]INDOLE, 4,7-DICHLORO- |
MDL Number.: | MFCD17013022 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1Cl)[nH]c3c2ncnc3Cl |
InChi: | InChI=1S/C10H5Cl2N3/c11-5-1-2-6-7(3-5)15-9-8(6)13-4-14-10(9)12/h1-4,15H |
InChiKey: | InChIKey=LPNZLHUUNXZQFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.