* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1,3-BENZODIOXOL-4-AMINE,N-BUTYL-6-ETHYL- |
CAS: | 549548-22-3 |
English Synonyms: | 1,3-BENZODIOXOL-4-AMINE,N-BUTYL-6-ETHYL- |
MDL Number.: | MFCD18805446 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCCNc1cc(cc2c1OCO2)CC |
InChi: | InChI=1S/C13H19NO2/c1-3-5-6-14-11-7-10(4-2)8-12-13(11)16-9-15-12/h7-8,14H,3-6,9H2,1-2H3 |
InChiKey: | InChIKey=UDIZFUOIIYKTFZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.