* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-AZASPIRO[4.5]DECAN-2-ONE |
CAS: | 5498-74-8 |
English Synonyms: | 1-AZASPIRO[4.5]DECAN-2-ONE |
MDL Number.: | MFCD17215366 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1CCC2(CC1)CCC(=O)N2 |
InChi: | InChI=1S/C9H15NO/c11-8-4-7-9(10-8)5-2-1-3-6-9/h1-7H2,(H,10,11) |
InChiKey: | InChIKey=MLGGCQQIKCYTHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.